C34H39NO — CID 68577992
(8S,11R,13R,14S,16R,17S)-17-(cyclopropylmethyl)-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 68577992) has the molecular formula C34H39NO and a molecular weight of 477.69 g/mol. Its IUPAC name is (8S,11R,13R,14S,16R,17S)-17-(cyclopropylmethyl)-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13R,14S,16R,17S)-17-(cyclopropylmethyl)-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 68577992 |
| Molecular Formula | C34H39NO |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | (8S,11R,13R,14S,16R,17S)-17-(cyclopropylmethyl)-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(-c4cccnc4)cc3)C[C@]2(C)[C@H]1CC1CC1 |
| InChI | InChI=1S/C34H39NO/c1-21-16-32-29-13-11-25-18-27(36)12-14-28(25)33(29)30(19-34(32,2)31(21)17-22-5-6-22)24-9-7-23(8-10-24)26-4-3-15-35-20-26/h3-4,7-10,15,18,20-22,29-32H,5-6,11-14,16-17,19H2,1-2H3/t21-,29+,30-,31+,32+,34-/m1/s1 |
| InChIKey | DVHCTTPEBNPOAC-YAFIRQNASA-N |
| XLogP | 8.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |