C38H40N2O3 — CID 123171694
N-[4-(anilinomethyl)phenyl]-4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzamide (PubChem CID 123171694) has the molecular formula C38H40N2O3 and a molecular weight of 572.75 g/mol. Its IUPAC name is N-[4-(anilinomethyl)phenyl]-4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzamide.
| Compound Name | N-[4-(anilinomethyl)phenyl]-4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzamide |
|---|---|
| PubChem CID | 123171694 |
| Molecular Formula | C38H40N2O3 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | N-[4-(anilinomethyl)phenyl]-4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzamide |
| SMILES | CC12CC(c3ccc(C(=O)Nc4ccc(CNc5ccccc5)cc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C38H40N2O3/c1-38-22-33(36-31-18-16-30(41)21-27(31)13-17-32(36)34(38)19-20-35(38)42)25-9-11-26(12-10-25)37(43)40-29-14-7-24(8-15-29)23-39-28-5-3-2-4-6-28/h2-12,14-15,21,32-35,39,42H,13,16-20,22-23H2,1H3,(H,40,43) |
| InChIKey | BIZLMQQVYAXVHY-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |