C34H45NO3S — CID 145342532
3,3-dimethylbut-1-yne;17-hydroxy-13-methyl-11-[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 145342532) has the molecular formula C34H45NO3S and a molecular weight of 547.81 g/mol. Its IUPAC name is 3,3-dimethylbut-1-yne;17-hydroxy-13-methyl-11-[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 3,3-dimethylbut-1-yne;17-hydroxy-13-methyl-11-[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145342532 |
| Molecular Formula | C34H45NO3S |
| Molecular Weight | 547.81 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | 3,3-dimethylbut-1-yne;17-hydroxy-13-methyl-11-[4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C#CC(C)(C)C.CC12CC(c3ccc(N4CCS(=O)CC4)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C28H35NO3S.C6H10/c1-28-17-24(18-2-5-20(6-3-18)29-12-14-33(32)15-13-29)27-22-9-7-21(30)16-19(22)4-8-23(27)25(28)10-11-26(28)31;1-5-6(2,3)4/h2-3,5-6,16,23-26,31H,4,7-15,17H2,1H3;1H,2-4H3 |
| InChIKey | VVHMZVUZZORDHK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|