C30H46N2O — CID 171346831
1-[(8R,9S,13S,14S,17S)-13-methyl-3-(4-pyrrolidin-1-ylbutoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pyrrolidine (PubChem CID 171346831) has the molecular formula C30H46N2O and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-[(8R,9S,13S,14S,17S)-13-methyl-3-(4-pyrrolidin-1-ylbutoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pyrrolidine.
| Compound Name | 1-[(8R,9S,13S,14S,17S)-13-methyl-3-(4-pyrrolidin-1-ylbutoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pyrrolidine |
|---|---|
| PubChem CID | 171346831 |
| Molecular Formula | C30H46N2O |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | 1-[(8R,9S,13S,14S,17S)-13-methyl-3-(4-pyrrolidin-1-ylbutoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pyrrolidine |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCCN5CCCC5)cc4CC[C@H]3[C@@H]1CC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C30H46N2O/c1-30-15-14-26-25-11-9-24(33-21-7-6-18-31-16-2-3-17-31)22-23(25)8-10-27(26)28(30)12-13-29(30)32-19-4-5-20-32/h9,11,22,26-29H,2-8,10,12-21H2,1H3/t26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | BBPNHCYTOLQTJQ-ZNOUKXQUSA-N |
| XLogP | 6.26 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|