C28H43IO6 — CID 59871988
(8R,9S,13S,14S,17S)-3-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 59871988) has the molecular formula C28H43IO6 and a molecular weight of 602.55 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-3-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59871988 |
| Molecular Formula | C28H43IO6 |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3-[2-[2-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCOCCOCCOCCOCCI)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C28H43IO6/c1-28-9-8-24-23-5-3-22(20-21(23)2-4-25(24)26(28)6-7-27(28)30)35-19-18-34-17-16-33-15-14-32-13-12-31-11-10-29/h3,5,20,24-27,30H,2,4,6-19H2,1H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | HQOOLTZRYMCOJC-MASCHLQQSA-N |
| XLogP | 4.78 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|