C29H42N2O2 — CID 155549506
1-[3-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]propyl]pyrrolidin-2-one (PubChem CID 155549506) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 1-[3-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155549506 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 1-[3-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]propyl]pyrrolidin-2-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCN5CCCC5=O)cc4CC[C@H]3[C@@H]1CC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C29H42N2O2/c1-29-14-13-24-23-10-8-22(33-19-5-18-31-17-4-6-28(31)32)20-21(23)7-9-25(24)26(29)11-12-27(29)30-15-2-3-16-30/h8,10,20,24-27H,2-7,9,11-19H2,1H3/t24-,25-,26+,27+,29+/m1/s1 |
| InChIKey | GYUZLAIYHZYQPU-GVGNIZHQSA-N |
| XLogP | 5.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|