C30H38ClNO3S — CID 70128352
(8S,9R,11S,13S,14S,17S)-4-chloro-13-methyl-11-[4-(2-thiomorpholin-4-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70128352) has the molecular formula C30H38ClNO3S and a molecular weight of 528.16 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,17S)-4-chloro-13-methyl-11-[4-(2-thiomorpholin-4-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9R,11S,13S,14S,17S)-4-chloro-13-methyl-11-[4-(2-thiomorpholin-4-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70128352 |
| Molecular Formula | C30H38ClNO3S |
| Molecular Weight | 528.16 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (8S,9R,11S,13S,14S,17S)-4-chloro-13-methyl-11-[4-(2-thiomorpholin-4-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12C[C@H](c3ccc(OCCN4CCSCC4)cc3)[C@@H]3c4ccc(O)c(Cl)c4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C30H38ClNO3S/c1-30-18-24(19-2-4-20(5-3-19)35-15-12-32-13-16-36-17-14-32)28-21-8-10-26(33)29(31)22(21)6-7-23(28)25(30)9-11-27(30)34/h2-5,8,10,23-25,27-28,33-34H,6-7,9,11-18H2,1H3/t23-,24+,25-,27-,28+,30-/m0/s1 |
| InChIKey | UJJXPVVEKSSTRX-BAWYVGMJSA-N |
| XLogP | 6.08 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.16 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |