C31H42ClNO3 — CID 20657698
(8S,9R,11S,13S,14S,17S)-11-[4-[2-[butyl(methyl)amino]ethoxy]phenyl]-4-chloro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 20657698) has the molecular formula C31H42ClNO3 and a molecular weight of 512.13 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S,17S)-11-[4-[2-[butyl(methyl)amino]ethoxy]phenyl]-4-chloro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9R,11S,13S,14S,17S)-11-[4-[2-[butyl(methyl)amino]ethoxy]phenyl]-4-chloro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 20657698 |
| Molecular Formula | C31H42ClNO3 |
| Molecular Weight | 512.13 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | (8S,9R,11S,13S,14S,17S)-11-[4-[2-[butyl(methyl)amino]ethoxy]phenyl]-4-chloro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCCCN(C)CCOc1ccc([C@H]2C[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]3CCc4c(ccc(O)c4Cl)[C@H]32)cc1 |
| InChI | InChI=1S/C31H42ClNO3/c1-4-5-16-33(3)17-18-36-21-8-6-20(7-9-21)25-19-31(2)26(13-15-28(31)35)24-11-10-23-22(29(24)25)12-14-27(34)30(23)32/h6-9,12,14,24-26,28-29,34-35H,4-5,10-11,13,15-19H2,1-3H3/t24-,25+,26-,28-,29+,31-/m0/s1 |
| InChIKey | XCBCJCALVWPEEE-YQPWVKCFSA-N |
| XLogP | 6.77 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.13 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |