C39H55NO5 — CID 10167958
[(8S,11S,13S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[8-[methyl(propan-2-yl)amino]-8-oxooctoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10167958) has the molecular formula C39H55NO5 and a molecular weight of 617.87 g/mol. Its IUPAC name is [(8S,11S,13S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[8-[methyl(propan-2-yl)amino]-8-oxooctoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,11S,13S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[8-[methyl(propan-2-yl)amino]-8-oxooctoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10167958 |
| Molecular Formula | C39H55NO5 |
| Molecular Weight | 617.87 g/mol |
| Exact Mass | 617.41 |
| IUPAC Name | [(8S,11S,13S,17S)-17-hydroxy-8,13-dimethyl-11-[4-[8-[methyl(propan-2-yl)amino]-8-oxooctoxy]phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC[C@]1(C)C2[C@@H](c2ccc(OCCCCCCCC(=O)N(C)C(C)C)cc2)C[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C39H55NO5/c1-26(2)40(6)36(43)12-10-8-7-9-11-23-44-30-15-13-28(14-16-30)33-25-39(5)34(19-20-35(39)42)38(4)22-21-29-24-31(45-27(3)41)17-18-32(29)37(33)38/h13-18,24,26,33-35,37,42H,7-12,19-23,25H2,1-6H3/t33-,34?,35+,37?,38+,39+/m1/s1 |
| InChIKey | PGYKJVRVXCZRGV-IICOQJGPSA-N |
| XLogP | 8.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.87 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|