C39H52O5S — CID 91282775
S-[5-[4-[(8R,9S,11S,13S,14R)-3-methoxy-13-methyl-8-[2-[(2S)-oxan-2-yl]oxyethenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]phenoxy]pentyl] ethanethioate (PubChem CID 91282775) has the molecular formula C39H52O5S and a molecular weight of 632.91 g/mol. Its IUPAC name is S-[5-[4-[(8R,9S,11S,13S,14R)-3-methoxy-13-methyl-8-[2-[(2S)-oxan-2-yl]oxyethenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]phenoxy]pentyl] ethanethioate.
| Compound Name | S-[5-[4-[(8R,9S,11S,13S,14R)-3-methoxy-13-methyl-8-[2-[(2S)-oxan-2-yl]oxyethenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]phenoxy]pentyl] ethanethioate |
|---|---|
| PubChem CID | 91282775 |
| Molecular Formula | C39H52O5S |
| Molecular Weight | 632.91 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | S-[5-[4-[(8R,9S,11S,13S,14R)-3-methoxy-13-methyl-8-[2-[(2S)-oxan-2-yl]oxyethenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]phenoxy]pentyl] ethanethioate |
| SMILES | COc1ccc2c(c1)CC[C@@]1(C=CO[C@H]3CCCCO3)[C@@H]3CCC[C@@]3(C)C[C@H](c3ccc(OCCCCCSC(C)=O)cc3)[C@H]21 |
| InChI | InChI=1S/C39H52O5S/c1-28(40)45-25-8-4-6-22-42-31-14-12-29(13-15-31)34-27-38(2)19-9-10-35(38)39(21-24-44-36-11-5-7-23-43-36)20-18-30-26-32(41-3)16-17-33(30)37(34)39/h12-17,21,24,26,34-37H,4-11,18-20,22-23,25,27H2,1-3H3/t34-,35-,36+,37+,38+,39-/m1/s1 |
| InChIKey | ZGBRSTXXWXSGLN-VWODFMBNSA-N |
| XLogP | 9.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.91 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|