C34H45ClO5 — CID 20583567
[(1S,3aS,5R,6S,7aS)-6-[4-(5-chloropentoxy)phenyl]-7a-methyl-5-[4-(oxan-2-yloxy)phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate (PubChem CID 20583567) has the molecular formula C34H45ClO5 and a molecular weight of 569.18 g/mol. Its IUPAC name is [(1S,3aS,5R,6S,7aS)-6-[4-(5-chloropentoxy)phenyl]-7a-methyl-5-[4-(oxan-2-yloxy)phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate.
| Compound Name | [(1S,3aS,5R,6S,7aS)-6-[4-(5-chloropentoxy)phenyl]-7a-methyl-5-[4-(oxan-2-yloxy)phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate |
|---|---|
| PubChem CID | 20583567 |
| Molecular Formula | C34H45ClO5 |
| Molecular Weight | 569.18 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | [(1S,3aS,5R,6S,7aS)-6-[4-(5-chloropentoxy)phenyl]-7a-methyl-5-[4-(oxan-2-yloxy)phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2C[C@@H](c3ccc(OC4CCCCO4)cc3)[C@@H](c3ccc(OCCCCCCl)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H45ClO5/c1-24(36)39-32-18-13-27-22-30(25-11-16-29(17-12-25)40-33-8-4-7-21-38-33)31(23-34(27,32)2)26-9-14-28(15-10-26)37-20-6-3-5-19-35/h9-12,14-17,27,30-33H,3-8,13,18-23H2,1-2H3/t27-,30-,31+,32-,33?,34-/m0/s1 |
| InChIKey | PHINKBJZHPTYJT-FGOQSYFMSA-N |
| XLogP | 8.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.18 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|