C18H26O3 — CID 15234651
[(1R,2S)-2-(4-butoxyphenyl)cyclohexyl] acetate (PubChem CID 15234651) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is [(1R,2S)-2-(4-butoxyphenyl)cyclohexyl] acetate.
| Compound Name | [(1R,2S)-2-(4-butoxyphenyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 15234651 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [(1R,2S)-2-(4-butoxyphenyl)cyclohexyl] acetate |
| SMILES | CCCCOc1ccc([C@@H]2CCCC[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C18H26O3/c1-3-4-13-20-16-11-9-15(10-12-16)17-7-5-6-8-18(17)21-14(2)19/h9-12,17-18H,3-8,13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | ZUOHGPYEJUGQBF-ZWKOTPCHSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|