C28H40O2 — CID 56632002
1-[(1R,2S)-2-methoxycyclohexyl]-4-(4-nonoxyphenyl)benzene (PubChem CID 56632002) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methoxycyclohexyl]-4-(4-nonoxyphenyl)benzene.
| Compound Name | 1-[(1R,2S)-2-methoxycyclohexyl]-4-(4-nonoxyphenyl)benzene |
|---|---|
| PubChem CID | 56632002 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 1-[(1R,2S)-2-methoxycyclohexyl]-4-(4-nonoxyphenyl)benzene |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc([C@H]3CCCC[C@@H]3OC)cc2)cc1 |
| InChI | InChI=1S/C28H40O2/c1-3-4-5-6-7-8-11-22-30-26-20-18-24(19-21-26)23-14-16-25(17-15-23)27-12-9-10-13-28(27)29-2/h14-21,27-28H,3-13,22H2,1-2H3/t27-,28+/m1/s1 |
| InChIKey | GUHFIAIVMXIKTD-IZLXSDGUSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|