C19H26O4 — CID 56986167
[(1S,2R)-2-[3-(oxan-2-yloxy)phenyl]cyclohexyl] acetate (PubChem CID 56986167) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is [(1S,2R)-2-[3-(oxan-2-yloxy)phenyl]cyclohexyl] acetate.
| Compound Name | [(1S,2R)-2-[3-(oxan-2-yloxy)phenyl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 56986167 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [(1S,2R)-2-[3-(oxan-2-yloxy)phenyl]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CCCC[C@@H]1c1cccc(OC2CCCCO2)c1 |
| InChI | InChI=1S/C19H26O4/c1-14(20)22-18-10-3-2-9-17(18)15-7-6-8-16(13-15)23-19-11-4-5-12-21-19/h6-8,13,17-19H,2-5,9-12H2,1H3/t17-,18+,19?/m1/s1 |
| InChIKey | OSBBZWAFPIEAQY-YTYFACEESA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |