C20H28O4 — CID 54097033
[(1R,2S)-2-[4-(oxan-2-yloxy)phenyl]cyclohexyl] propanoate (PubChem CID 54097033) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1R,2S)-2-[4-(oxan-2-yloxy)phenyl]cyclohexyl] propanoate.
| Compound Name | [(1R,2S)-2-[4-(oxan-2-yloxy)phenyl]cyclohexyl] propanoate |
|---|---|
| PubChem CID | 54097033 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1R,2S)-2-[4-(oxan-2-yloxy)phenyl]cyclohexyl] propanoate |
| SMILES | CCC(=O)O[C@@H]1CCCC[C@H]1c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C20H28O4/c1-2-19(21)24-18-8-4-3-7-17(18)15-10-12-16(13-11-15)23-20-9-5-6-14-22-20/h10-13,17-18,20H,2-9,14H2,1H3/t17-,18+,20?/m0/s1 |
| InChIKey | MXVNTNWZROYUFV-IVAAQHKWSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |