C19H28O5 — CID 57088320
[(1S,2R)-2-[4-[ethoxy(methoxy)methoxy]phenyl]cyclohexyl] propanoate (PubChem CID 57088320) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(1S,2R)-2-[4-[ethoxy(methoxy)methoxy]phenyl]cyclohexyl] propanoate.
| Compound Name | [(1S,2R)-2-[4-[ethoxy(methoxy)methoxy]phenyl]cyclohexyl] propanoate |
|---|---|
| PubChem CID | 57088320 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [(1S,2R)-2-[4-[ethoxy(methoxy)methoxy]phenyl]cyclohexyl] propanoate |
| SMILES | CCOC(OC)Oc1ccc([C@H]2CCCC[C@@H]2OC(=O)CC)cc1 |
| InChI | InChI=1S/C19H28O5/c1-4-18(20)24-17-9-7-6-8-16(17)14-10-12-15(13-11-14)23-19(21-3)22-5-2/h10-13,16-17,19H,4-9H2,1-3H3/t16-,17+,19?/m1/s1 |
| InChIKey | TXSNIXCLWODFGF-FQZXCLDYSA-N |
| XLogP | 4.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|