C18H24O5 — CID 68545486
methyl (3R,4R)-4-[4-(oxan-2-yloxy)phenyl]oxane-3-carboxylate (PubChem CID 68545486) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (3R,4R)-4-[4-(oxan-2-yloxy)phenyl]oxane-3-carboxylate.
| Compound Name | methyl (3R,4R)-4-[4-(oxan-2-yloxy)phenyl]oxane-3-carboxylate |
|---|---|
| PubChem CID | 68545486 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl (3R,4R)-4-[4-(oxan-2-yloxy)phenyl]oxane-3-carboxylate |
| SMILES | COC(=O)[C@H]1COCC[C@H]1c1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C18H24O5/c1-20-18(19)16-12-21-11-9-15(16)13-5-7-14(8-6-13)23-17-4-2-3-10-22-17/h5-8,15-17H,2-4,9-12H2,1H3/t15-,16-,17?/m0/s1 |
| InChIKey | FPGMPGNXFRVWDC-PYNWJHIZSA-N |
| XLogP | 2.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |