C31H38O6 — CID 11306725
[4-[[(1S,2R,4S,6S)-1-methyl-6-[4-(oxan-2-yloxy)phenyl]-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]oxymethyl]phenyl]methyl acetate (PubChem CID 11306725) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is [4-[[(1S,2R,4S,6S)-1-methyl-6-[4-(oxan-2-yloxy)phenyl]-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]oxymethyl]phenyl]methyl acetate.
| Compound Name | [4-[[(1S,2R,4S,6S)-1-methyl-6-[4-(oxan-2-yloxy)phenyl]-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]oxymethyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 11306725 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | [4-[[(1S,2R,4S,6S)-1-methyl-6-[4-(oxan-2-yloxy)phenyl]-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-yl]oxymethyl]phenyl]methyl acetate |
| SMILES | C=C(C)[C@H]1C[C@@H](OCc2ccc(COC(C)=O)cc2)[C@]2(C)O[C@]2(c2ccc(OC3CCCCO3)cc2)C1 |
| InChI | InChI=1S/C31H38O6/c1-21(2)25-17-28(35-20-24-10-8-23(9-11-24)19-34-22(3)32)30(4)31(18-25,37-30)26-12-14-27(15-13-26)36-29-7-5-6-16-33-29/h8-15,25,28-29H,1,5-7,16-20H2,2-4H3/t25-,28+,29?,30-,31-/m0/s1 |
| InChIKey | OIUYGLQTHRCREW-GZOLZLNRSA-N |
| XLogP | 6.21 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|