C27H38O3 — CID 91006983
2-[1-[(8R,9S,13S,14R)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-8-yl]prop-1-en-2-yloxy]oxane (PubChem CID 91006983) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-[1-[(8R,9S,13S,14R)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-8-yl]prop-1-en-2-yloxy]oxane.
| Compound Name | 2-[1-[(8R,9S,13S,14R)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-8-yl]prop-1-en-2-yloxy]oxane |
|---|---|
| PubChem CID | 91006983 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-[1-[(8R,9S,13S,14R)-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-8-yl]prop-1-en-2-yloxy]oxane |
| SMILES | COc1ccc2c(c1)CC[C@]1(C=C(C)OC3CCCCO3)[C@@H]2CC[C@]2(C)CCC[C@H]21 |
| InChI | InChI=1S/C27H38O3/c1-19(30-25-8-4-5-16-29-25)18-27-15-11-20-17-21(28-3)9-10-22(20)23(27)12-14-26(2)13-6-7-24(26)27/h9-10,17-18,23-25H,4-8,11-16H2,1-3H3/t23-,24-,25?,26+,27+/m1/s1 |
| InChIKey | SCBJNBBYCYPNKB-JETHTLQNSA-N |
| XLogP | 6.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|