C21H27FO2 — CID 68657564
(8S,9S,13S,14S,16R,17R)-8-ethenyl-16-fluoro-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 68657564) has the molecular formula C21H27FO2 and a molecular weight of 330.44 g/mol. Its IUPAC name is (8S,9S,13S,14S,16R,17R)-8-ethenyl-16-fluoro-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,13S,14S,16R,17R)-8-ethenyl-16-fluoro-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 68657564 |
| Molecular Formula | C21H27FO2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (8S,9S,13S,14S,16R,17R)-8-ethenyl-16-fluoro-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=C[C@@]12CCc3cc(OC)ccc3[C@H]1CC[C@@]1(C)[C@H]2C[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C21H27FO2/c1-4-21-10-7-13-11-14(24-3)5-6-15(13)16(21)8-9-20(2)18(21)12-17(22)19(20)23/h4-6,11,16-19,23H,1,7-10,12H2,2-3H3/t16-,17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | DKIKJIHWRNWGNA-COXXTLHVSA-N |
| XLogP | 4.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|