C34H35NO6S — CID 16662218
[(8S,9S,13S,14S,17S)-3-benzoyloxy-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate (PubChem CID 16662218) has the molecular formula C34H35NO6S and a molecular weight of 585.72 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17S)-3-benzoyloxy-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate.
| Compound Name | [(8S,9S,13S,14S,17S)-3-benzoyloxy-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16662218 |
| Molecular Formula | C34H35NO6S |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | [(8S,9S,13S,14S,17S)-3-benzoyloxy-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate |
| SMILES | C=C[C@@]12CCc3cc(OC(=O)c4ccccc4)ccc3[C@H]1CC[C@]1(C)[C@@H](OC(=O)c3ccc(S(N)(=O)=O)cc3)CC[C@H]12 |
| InChI | InChI=1S/C34H35NO6S/c1-3-34-20-17-24-21-25(40-31(36)22-7-5-4-6-8-22)11-14-27(24)28(34)18-19-33(2)29(34)15-16-30(33)41-32(37)23-9-12-26(13-10-23)42(35,38)39/h3-14,21,28-30H,1,15-20H2,2H3,(H2,35,38,39)/t28-,29-,30+,33+,34-/m1/s1 |
| InChIKey | PUAYMNFDOYHWNX-GEEZMZIESA-N |
| XLogP | 6.19 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|