C27H31NO5S — CID 90757796
[(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate (PubChem CID 90757796) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is [(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate.
| Compound Name | [(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 90757796 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] 3-sulfamoylbenzoate |
| SMILES | C=CC12CCc3cc(O)ccc3C1CC[C@@]1(C)C2CC[C@@H]1OC(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C27H31NO5S/c1-3-27-14-11-17-15-19(29)7-8-21(17)22(27)12-13-26(2)23(27)9-10-24(26)33-25(30)18-5-4-6-20(16-18)34(28,31)32/h3-8,15-16,22-24,29H,1,9-14H2,2H3,(H2,28,31,32)/t22?,23?,24-,26-,27?/m0/s1 |
| InChIKey | XXNSQCBQTZCBKC-GGWLXUJESA-N |
| XLogP | 4.68 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|