C27H30FNO5S — CID 68811666
[(8S,9R,13S,14S,16R,17R)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 3-sulfamoylbenzoate (PubChem CID 68811666) has the molecular formula C27H30FNO5S and a molecular weight of 499.60 g/mol. Its IUPAC name is [(8S,9R,13S,14S,16R,17R)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 3-sulfamoylbenzoate.
| Compound Name | [(8S,9R,13S,14S,16R,17R)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 68811666 |
| Molecular Formula | C27H30FNO5S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | [(8S,9R,13S,14S,16R,17R)-9-ethenyl-17-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 3-sulfamoylbenzoate |
| SMILES | C=C[C@]12CC[C@]3(C)[C@@H](F)[C@H](OC(=O)c4cccc(S(N)(=O)=O)c4)C[C@H]3[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C27H30FNO5S/c1-3-27-12-11-26(2)22(21(27)9-7-16-13-18(30)8-10-20(16)27)15-23(24(26)28)34-25(31)17-5-4-6-19(14-17)35(29,32)33/h3-6,8,10,13-14,21-24,30H,1,7,9,11-12,15H2,2H3,(H2,29,32,33)/t21-,22-,23+,24-,26-,27+/m0/s1 |
| InChIKey | DTDCTAXVEASPTE-KFWLJMEHSA-N |
| XLogP | 4.41 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|