C25H29NO7S — CID 11540380
[(13S,15R,16S,17R)-3,16,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl] 3-sulfamoylbenzoate (PubChem CID 11540380) has the molecular formula C25H29NO7S and a molecular weight of 487.57 g/mol. Its IUPAC name is [(13S,15R,16S,17R)-3,16,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl] 3-sulfamoylbenzoate.
| Compound Name | [(13S,15R,16S,17R)-3,16,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl] 3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 11540380 |
| Molecular Formula | C25H29NO7S |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [(13S,15R,16S,17R)-3,16,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-15-yl] 3-sulfamoylbenzoate |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1C(OC(=O)c1cccc(S(N)(=O)=O)c1)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C25H29NO7S/c1-25-10-9-18-17-8-6-15(27)11-13(17)5-7-19(18)20(25)22(21(28)23(25)29)33-24(30)14-3-2-4-16(12-14)34(26,31)32/h2-4,6,8,11-12,18-23,27-29H,5,7,9-10H2,1H3,(H2,26,31,32)/t18?,19?,20?,21-,22?,23+,25+/m1/s1 |
| InChIKey | LYEUMNAHZTZDLM-MZILWHQQSA-N |
| XLogP | 2.06 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |