C27H34NO3+ — CID 10325182
[(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propylpyridin-1-ium-3-carboxylate (PubChem CID 10325182) has the molecular formula C27H34NO3+ and a molecular weight of 420.57 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propylpyridin-1-ium-3-carboxylate.
| Compound Name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 10325182 |
| Molecular Formula | C27H34NO3+ |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propylpyridin-1-ium-3-carboxylate |
| SMILES | CCC[n+]1cccc(C(=O)O[C@@H]2CC[C@H]3[C@@H]4CCc5cc(O)ccc5[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C27H33NO3/c1-3-14-28-15-4-5-19(17-28)26(30)31-25-11-10-24-23-8-6-18-16-20(29)7-9-21(18)22(23)12-13-27(24,25)2/h4-5,7,9,15-17,22-25H,3,6,8,10-14H2,1-2H3/p+1/t22-,23-,24+,25-,27+/m1/s1 |
| InChIKey | FHFCVHXUBMSCAA-NUPXYHBHSA-O |
| XLogP | 5.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|