C27H34INO3 — CID 10415072
[(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propan-2-ylpyridin-1-ium-3-carboxylate iodide (PubChem CID 10415072) has the molecular formula C27H34INO3 and a molecular weight of 547.48 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propan-2-ylpyridin-1-ium-3-carboxylate iodide.
| Compound Name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propan-2-ylpyridin-1-ium-3-carboxylate iodide |
|---|---|
| PubChem CID | 10415072 |
| Molecular Formula | C27H34INO3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-propan-2-ylpyridin-1-ium-3-carboxylate iodide |
| SMILES | CC(C)[n+]1cccc(C(=O)O[C@@H]2CC[C@H]3[C@@H]4CCc5cc(O)ccc5[C@H]4CC[C@]23C)c1.[I-] |
| InChI | InChI=1S/C27H33NO3.HI/c1-17(2)28-14-4-5-19(16-28)26(30)31-25-11-10-24-23-8-6-18-15-20(29)7-9-21(18)22(23)12-13-27(24,25)3;/h4-5,7,9,14-17,22-25H,6,8,10-13H2,1-3H3;1H/t22-,23-,24+,25-,27+;/m1./s1 |
| InChIKey | GNBUSCSUZBUOON-HIUQAGJGSA-N |
| XLogP | 2.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|