C23H30O3 — CID 10360798
[(8S,9R,13R,14S,16R)-9-ethenyl-13-ethyl-3-hydroxy-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 10360798) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is [(8S,9R,13R,14S,16R)-9-ethenyl-13-ethyl-3-hydroxy-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8S,9R,13R,14S,16R)-9-ethenyl-13-ethyl-3-hydroxy-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 10360798 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(8S,9R,13R,14S,16R)-9-ethenyl-13-ethyl-3-hydroxy-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | C=C[C@]12CC[C@]3(CC)C[C@H](OC(C)=O)C[C@H]3[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C23H30O3/c1-4-22-10-11-23(5-2)19-9-7-17(25)12-16(19)6-8-20(23)21(22)13-18(14-22)26-15(3)24/h5,7,9,12,18,20-21,25H,2,4,6,8,10-11,13-14H2,1,3H3/t18-,20+,21+,22-,23-/m1/s1 |
| InChIKey | OIQZQHPDQXZXGW-YDXQKAQTSA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|