C21H30O2 — CID 90910768
(8S,13R,14S)-13-methyl-9-propyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 90910768) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (8S,13R,14S)-13-methyl-9-propyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (8S,13R,14S)-13-methyl-9-propyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 90910768 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (8S,13R,14S)-13-methyl-9-propyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CCCC12CC[C@]3(C)CC(O)C[C@H]3[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C21H30O2/c1-3-8-21-10-9-20(2)13-16(23)12-19(20)18(21)6-4-14-11-15(22)5-7-17(14)21/h5,7,11,16,18-19,22-23H,3-4,6,8-10,12-13H2,1-2H3/t16?,18-,19-,20+,21?/m0/s1 |
| InChIKey | VWAHIVOFRSQMGC-ZQZWVVTOSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |