C23H32O2 — CID 10382650
(8S,9R,13R,14S,16R)-13-ethyl-3-methoxy-9-prop-2-enyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-ol (PubChem CID 10382650) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is (8S,9R,13R,14S,16R)-13-ethyl-3-methoxy-9-prop-2-enyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (8S,9R,13R,14S,16R)-13-ethyl-3-methoxy-9-prop-2-enyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 10382650 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (8S,9R,13R,14S,16R)-13-ethyl-3-methoxy-9-prop-2-enyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-ol |
| SMILES | C=CC[C@]12CC[C@]3(CC)C[C@H](O)C[C@H]3[C@@H]1CCc1cc(OC)ccc12 |
| InChI | InChI=1S/C23H32O2/c1-4-10-23-12-11-22(5-2)15-17(24)14-21(22)20(23)8-6-16-13-18(25-3)7-9-19(16)23/h4,7,9,13,17,20-21,24H,1,5-6,8,10-12,14-15H2,2-3H3/t17-,20+,21+,22-,23-/m1/s1 |
| InChIKey | NVQLLFVMDWTKFL-SUHOFRIBSA-N |
| XLogP | 5.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|