C23H38O3Si — CID 24751393
[(1R,4aS,10aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]methanol (PubChem CID 24751393) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is [(1R,4aS,10aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]methanol.
| Compound Name | [(1R,4aS,10aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]methanol |
|---|---|
| PubChem CID | 24751393 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(1R,4aS,10aR)-4a-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]methanol |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@H](CO)CCC[C@@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38O3Si/c1-22(2,3)27(5,6)26-16-23-13-7-8-18(15-24)21(23)11-9-17-14-19(25-4)10-12-20(17)23/h10,12,14,18,21,24H,7-9,11,13,15-16H2,1-6H3/t18-,21+,23+/m0/s1 |
| InChIKey | CNAQUZVYEFYCFM-QTGUNEKASA-N |
| XLogP | 5.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|