C28H42O3Si — CID 24941820
(1R,4S,5S,10S,20R)-5-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-4-methylpentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraen-20-ol (PubChem CID 24941820) has the molecular formula C28H42O3Si and a molecular weight of 454.73 g/mol. Its IUPAC name is (1R,4S,5S,10S,20R)-5-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-4-methylpentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraen-20-ol.
| Compound Name | (1R,4S,5S,10S,20R)-5-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-4-methylpentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraen-20-ol |
|---|---|
| PubChem CID | 24941820 |
| Molecular Formula | C28H42O3Si |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (1R,4S,5S,10S,20R)-5-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-4-methylpentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraen-20-ol |
| SMILES | COc1ccc2c(c1)C[C@H]1C3=C4CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@]32CC[C@H]1O |
| InChI | InChI=1S/C28H42O3Si/c1-26(2,3)32(6,7)31-24-11-10-22-25-20-17-18-16-19(30-5)8-9-21(18)28(25,13-12-23(20)29)15-14-27(22,24)4/h8-9,16,20,23-24,29H,10-15,17H2,1-7H3/t20-,23-,24+,27+,28+/m1/s1 |
| InChIKey | PFMSWLJFJGGQLI-MPWQZKGVSA-N |
| XLogP | 6.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|