C50H68O7Si — CID 100998281
bis[[(1S,4aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl] 4-[tert-butyl(dimethyl)silyl]oxybenzene-1,2-dicarboxylate (PubChem CID 100998281) has the molecular formula C50H68O7Si and a molecular weight of 809.17 g/mol. Its IUPAC name is bis[[(1S,4aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl] 4-[tert-butyl(dimethyl)silyl]oxybenzene-1,2-dicarboxylate.
| Compound Name | bis[[(1S,4aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl] 4-[tert-butyl(dimethyl)silyl]oxybenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 100998281 |
| Molecular Formula | C50H68O7Si |
| Molecular Weight | 809.17 g/mol |
| Exact Mass | 808.47 |
| IUPAC Name | bis[[(1S,4aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl] 4-[tert-butyl(dimethyl)silyl]oxybenzene-1,2-dicarboxylate |
| SMILES | COc1ccc2c(c1)[C@@]1(C)CCC[C@](C)(COC(=O)c3ccc(O[Si](C)(C)C(C)(C)C)cc3C(=O)OC[C@@]3(C)CCC[C@]4(C)c5cc(OC)ccc5CCC34)C1CC2 |
| InChI | InChI=1S/C50H68O7Si/c1-46(2,3)58(10,11)57-37-20-21-38(44(51)55-31-47(4)24-12-26-49(6)40-29-35(53-8)18-14-33(40)16-22-42(47)49)39(28-37)45(52)56-32-48(5)25-13-27-50(7)41-30-36(54-9)19-15-34(41)17-23-43(48)50/h14-15,18-21,28-30,42-43H,12-13,16-17,22-27,31-32H2,1-11H3/t42?,43?,47-,48-,49-,50-/m1/s1 |
| InChIKey | IXDSZIOIRZDAKQ-LIHMNSSJSA-N |
| XLogP | 11.82 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.17 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|