C26H40O2Si — CID 11395832
tert-butyl-[[(8R,9S,13S,14S,17S)-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 11395832) has the molecular formula C26H40O2Si and a molecular weight of 412.69 g/mol. Its IUPAC name is tert-butyl-[[(8R,9S,13S,14S,17S)-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8R,9S,13S,14S,17S)-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11395832 |
| Molecular Formula | C26H40O2Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | tert-butyl-[[(8R,9S,13S,14S,17S)-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | COc1ccc2c(c1)C=C(C)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C26H40O2Si/c1-17-15-18-16-19(27-6)9-10-20(18)21-13-14-26(5)22(24(17)21)11-12-23(26)28-29(7,8)25(2,3)4/h9-10,15-16,21-24H,11-14H2,1-8H3/t21-,22+,23+,24-,26+/m1/s1 |
| InChIKey | CXGJHAFAUMBHEJ-XPICPDFBSA-N |
| XLogP | 7.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|