C29H48O4Si — CID 10814877
(7R,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(2-hydroxyethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 10814877) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(2-hydroxyethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (7R,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(2-hydroxyethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10814877 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(2-hydroxyethoxy)propyl]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3[C@H](CCCOCCO)Cc4cc(O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H48O4Si/c1-28(2,3)34(5,6)33-26-12-11-25-27-20(8-7-16-32-17-15-30)18-21-19-22(31)9-10-23(21)24(27)13-14-29(25,26)4/h9-10,19-20,24-27,30-31H,7-8,11-18H2,1-6H3/t20-,24-,25+,26+,27-,29+/m1/s1 |
| InChIKey | UTNPZPUUDLKJDV-XJDQCCKNSA-N |
| XLogP | 6.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|