C34H54O3Si — CID 70127187
(8R,9R,10S,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(3-hydroxyphenyl)propyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70127187) has the molecular formula C34H54O3Si and a molecular weight of 538.89 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(3-hydroxyphenyl)propyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(3-hydroxyphenyl)propyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70127187 |
| Molecular Formula | C34H54O3Si |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-[3-(3-hydroxyphenyl)propyl]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@H]2[C@@H]3C(CCCc4cccc(O)c4)CC4CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C34H54O3Si/c1-32(2,3)38(6,7)37-30-15-14-28-31-24(12-8-10-23-11-9-13-26(35)20-23)21-25-22-27(36)16-18-33(25,4)29(31)17-19-34(28,30)5/h9,11,13,20,24-25,28-31,35H,8,10,12,14-19,21-22H2,1-7H3/t24?,25?,28-,29+,30?,31-,33-,34-/m0/s1 |
| InChIKey | UNOXEEPWCPBMQM-JISXKTDESA-N |
| XLogP | 8.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|