C38H59NO3 — CID 70127289
N-[(4-tert-butylphenyl)methyl]-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide (PubChem CID 70127289) has the molecular formula C38H59NO3 and a molecular weight of 577.89 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide |
|---|---|
| PubChem CID | 70127289 |
| Molecular Formula | C38H59NO3 |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 577.45 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)CCCCCCCC2CC3CC(=O)CC[C@]3(C)[C@@H]3CC[C@]4(C)C(O)CC[C@H]4[C@H]23)cc1 |
| InChI | InChI=1S/C38H59NO3/c1-36(2,3)28-15-13-26(14-16-28)25-39-34(42)12-10-8-6-7-9-11-27-23-29-24-30(40)19-21-37(29,4)32-20-22-38(5)31(35(27)32)17-18-33(38)41/h13-16,27,29,31-33,35,41H,6-12,17-25H2,1-5H3,(H,39,42)/t27?,29?,31-,32+,33?,35-,37-,38-/m0/s1 |
| InChIKey | BJQTVQMDFFKCFU-VTTCSKEJSA-N |
| XLogP | 8.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|