C41H57NO3 — CID 70127537
N-(2,2-diphenylethyl)-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide (PubChem CID 70127537) has the molecular formula C41H57NO3 and a molecular weight of 611.91 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide.
| Compound Name | N-(2,2-diphenylethyl)-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide |
|---|---|
| PubChem CID | 70127537 |
| Molecular Formula | C41H57NO3 |
| Molecular Weight | 611.91 g/mol |
| Exact Mass | 611.43 |
| IUPAC Name | N-(2,2-diphenylethyl)-8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]octanamide |
| SMILES | C[C@]12CCC(=O)CC1CC(CCCCCCCC(=O)NCC(c1ccccc1)c1ccccc1)[C@@H]1[C@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C41H57NO3/c1-40-24-22-33(43)27-32(40)26-31(39-35-20-21-37(44)41(35,2)25-23-36(39)40)18-8-4-3-5-13-19-38(45)42-28-34(29-14-9-6-10-15-29)30-16-11-7-12-17-30/h6-7,9-12,14-17,31-32,34-37,39,44H,3-5,8,13,18-28H2,1-2H3,(H,42,45)/t31?,32?,35-,36+,37?,39-,40-,41-/m0/s1 |
| InChIKey | VELLLJLMPYXHJG-WTTUODCUSA-N |
| XLogP | 8.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.91 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|