C32H55NO3 — CID 70129083
8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-pentyloctanamide (PubChem CID 70129083) has the molecular formula C32H55NO3 and a molecular weight of 501.80 g/mol. Its IUPAC name is 8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-pentyloctanamide.
| Compound Name | 8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-pentyloctanamide |
|---|---|
| PubChem CID | 70129083 |
| Molecular Formula | C32H55NO3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.42 |
| IUPAC Name | 8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-pentyloctanamide |
| SMILES | CCCCCNC(=O)CCCCCCCC1CC2CC(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C32H55NO3/c1-4-5-11-20-33-29(36)13-10-8-6-7-9-12-23-21-24-22-25(34)16-18-31(24,2)27-17-19-32(3)26(30(23)27)14-15-28(32)35/h23-24,26-28,30,35H,4-22H2,1-3H3,(H,33,36)/t23?,24?,26-,27+,28?,30-,31-,32-/m0/s1 |
| InChIKey | QOQXMXUTGXSFQF-XZJSFXSISA-N |
| XLogP | 7.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|