C29H49NO4 — CID 70128904
8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-(2-hydroxyethyl)octanamide (PubChem CID 70128904) has the molecular formula C29H49NO4 and a molecular weight of 475.71 g/mol. Its IUPAC name is 8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-(2-hydroxyethyl)octanamide.
| Compound Name | 8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-(2-hydroxyethyl)octanamide |
|---|---|
| PubChem CID | 70128904 |
| Molecular Formula | C29H49NO4 |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | 8-[(8R,9R,10S,13S,14S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl]-N-(2-hydroxyethyl)octanamide |
| SMILES | C[C@]12CCC(=O)CC1CC(CCCCCCCC(=O)NCCO)[C@@H]1[C@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C29H49NO4/c1-28-14-12-22(32)19-21(28)18-20(8-6-4-3-5-7-9-26(34)30-16-17-31)27-23-10-11-25(33)29(23,2)15-13-24(27)28/h20-21,23-25,27,31,33H,3-19H2,1-2H3,(H,30,34)/t20?,21?,23-,24+,25?,27-,28-,29-/m0/s1 |
| InChIKey | BWJLOKKKLZCPRO-XCNHRMNLSA-N |
| XLogP | 5.02 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|