C29H52N2O4 — CID 142045795
10-amino-9-[(1S)-1-hydroxy-7a-methyl-5-(1-methyl-4-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]-N-(2-hydroxyethyl)decanamide (PubChem CID 142045795) has the molecular formula C29H52N2O4 and a molecular weight of 492.75 g/mol. Its IUPAC name is 10-amino-9-[(1S)-1-hydroxy-7a-methyl-5-(1-methyl-4-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]-N-(2-hydroxyethyl)decanamide.
| Compound Name | 10-amino-9-[(1S)-1-hydroxy-7a-methyl-5-(1-methyl-4-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]-N-(2-hydroxyethyl)decanamide |
|---|---|
| PubChem CID | 142045795 |
| Molecular Formula | C29H52N2O4 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.39 |
| IUPAC Name | 10-amino-9-[(1S)-1-hydroxy-7a-methyl-5-(1-methyl-4-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]-N-(2-hydroxyethyl)decanamide |
| SMILES | CC1(C2CCC3(C)C(CC[C@@H]3O)C2C(CN)CCCCCCCC(=O)NCCO)CCC(=O)CC1 |
| InChI | InChI=1S/C29H52N2O4/c1-28(15-12-22(33)13-16-28)23-14-17-29(2)24(10-11-25(29)34)27(23)21(20-30)8-6-4-3-5-7-9-26(35)31-18-19-32/h21,23-25,27,32,34H,3-20,30H2,1-2H3,(H,31,35)/t21?,23?,24?,25-,27?,29?/m0/s1 |
| InChIKey | NGLQEGDBOLXPAC-ZFQQTBNCSA-N |
| XLogP | 4.35 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|