C27H44O4Si — CID 91551091
(2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,12,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one (PubChem CID 91551091) has the molecular formula C27H44O4Si and a molecular weight of 460.73 g/mol. Its IUPAC name is (2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,12,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one.
| Compound Name | (2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,12,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one |
|---|---|
| PubChem CID | 91551091 |
| Molecular Formula | C27H44O4Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2R,12R,16S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4,12,16-trimethyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-6-en-9-one |
| SMILES | CC1OC2=C3CC(=O)CC[C@]3(C)C3CC[C@@]4(C)C(CC[C@@H]4O[Si](C)(C)C(C)(C)C)C3[C@H]2O1 |
| InChI | InChI=1S/C27H44O4Si/c1-16-29-23-20-15-17(28)11-13-26(20,5)19-12-14-27(6)18(22(19)24(23)30-16)9-10-21(27)31-32(7,8)25(2,3)4/h16,18-19,21-22,24H,9-15H2,1-8H3/t16?,18?,19?,21-,22?,24+,26+,27-/m0/s1 |
| InChIKey | JXBBQYBARGJYDY-ZQPOKPAESA-N |
| XLogP | 6.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|