C32H48O2Si — CID 70144991
(8R,9R,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-(4-methylphenyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70144991) has the molecular formula C32H48O2Si and a molecular weight of 492.82 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-(4-methylphenyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-(4-methylphenyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70144991 |
| Molecular Formula | C32H48O2Si |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-7-(4-methylphenyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | Cc1ccc(C2C=C3CC(=O)CC[C@]3(C)[C@@H]3CC[C@]4(C)C(O[Si](C)(C)C(C)(C)C)CC[C@H]4[C@H]23)cc1 |
| InChI | InChI=1S/C32H48O2Si/c1-21-9-11-22(12-10-21)25-20-23-19-24(33)15-17-31(23,5)27-16-18-32(6)26(29(25)27)13-14-28(32)34-35(7,8)30(2,3)4/h9-12,20,25-29H,13-19H2,1-8H3/t25?,26-,27+,28?,29-,31-,32-/m0/s1 |
| InChIKey | AXSKPQRWJPSAQB-YCWQUUFASA-N |
| XLogP | 8.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|