C31H47NO3SeSi — CID 139265419
tert-butyl-[[(3R)-10,13-dimethyl-3-(2-nitrophenyl)selanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 139265419) has the molecular formula C31H47NO3SeSi and a molecular weight of 588.77 g/mol. Its IUPAC name is tert-butyl-[[(3R)-10,13-dimethyl-3-(2-nitrophenyl)selanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3R)-10,13-dimethyl-3-(2-nitrophenyl)selanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 139265419 |
| Molecular Formula | C31H47NO3SeSi |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | tert-butyl-[[(3R)-10,13-dimethyl-3-(2-nitrophenyl)selanyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | CC12CC[C@@H]([Se]c3ccccc3[N+](=O)[O-])C=C1CCC1C2CCC2(C)C(O[Si](C)(C)C(C)(C)C)CCC12 |
| InChI | InChI=1S/C31H47NO3SeSi/c1-29(2,3)37(6,7)35-28-15-14-24-23-13-12-21-20-22(36-27-11-9-8-10-26(27)32(33)34)16-18-30(21,4)25(23)17-19-31(24,28)5/h8-11,20,22-25,28H,12-19H2,1-7H3/t22-,23?,24?,25?,28?,30?,31?/m1/s1 |
| InChIKey | WSZOSRHSDMFGKT-CVKKJWNMSA-N |
| XLogP | 8.07 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|