C26H44O5SSi — CID 11569548
[(1S,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] methanesulfonate (PubChem CID 11569548) has the molecular formula C26H44O5SSi and a molecular weight of 496.79 g/mol. Its IUPAC name is [(1S,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] methanesulfonate.
| Compound Name | [(1S,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 11569548 |
| Molecular Formula | C26H44O5SSi |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [(1S,8S,9S,10R,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C[C@H](OS(C)(=O)=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H44O5SSi/c1-24(2,3)33(7,8)31-22-12-11-20-19-10-9-17-15-18(27)16-23(30-32(6,28)29)26(17,5)21(19)13-14-25(20,22)4/h15,19-23H,9-14,16H2,1-8H3/t19-,20-,21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | MMZWCKSTPHSMDT-DRKCKIEBSA-N |
| XLogP | 5.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|