C30H50O2Si — CID 22865897
(8R,9S,10R,13S,14S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1-pent-4-enyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22865897) has the molecular formula C30H50O2Si and a molecular weight of 470.81 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1-pent-4-enyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1-pent-4-enyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22865897 |
| Molecular Formula | C30H50O2Si |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1-pent-4-enyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=CCCCC1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C30H50O2Si/c1-9-10-11-12-21-19-23(31)20-22-13-14-24-25-15-16-27(32-33(7,8)28(2,3)4)29(25,5)18-17-26(24)30(21,22)6/h9,20-21,24-27H,1,10-19H2,2-8H3/t21?,24-,25-,26-,27+,29-,30-/m0/s1 |
| InChIKey | OXLQNTVNLCEZAX-RPNBHWQVSA-N |
| XLogP | 8.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|