C33H57ClO2Si — CID 174025640
(7R,8R,9S,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-(9-chlorononyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 174025640) has the molecular formula C33H57ClO2Si and a molecular weight of 549.36 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-(9-chlorononyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8R,9S,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-(9-chlorononyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 174025640 |
| Molecular Formula | C33H57ClO2Si |
| Molecular Weight | 549.36 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S)-17-[tert-butyl(dimethyl)silyl]oxy-7-(9-chlorononyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@H]2[C@@H]3[C@H](CCCCCCCCCCl)CC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H57ClO2Si/c1-32(2,3)37(5,6)36-30-18-17-29-31-24(14-12-10-8-7-9-11-13-21-34)22-25-23-26(35)15-16-27(25)28(31)19-20-33(29,30)4/h23-24,27-31H,7-22H2,1-6H3/t24-,27+,28-,29+,30?,31-,33+/m1/s1 |
| InChIKey | HGXGYHFTKTXAAI-MBJQFJPBSA-N |
| XLogP | 10.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.36 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|