C31H51O4Si — CID 86753646
CID 86753646 (PubChem CID 86753646) has the molecular formula C31H51O4Si and a molecular weight of 515.83 g/mol.
| Compound Name | CID 86753646 |
|---|---|
| PubChem CID | 86753646 |
| Molecular Formula | C31H51O4Si |
| Molecular Weight | 515.83 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3[C@H](CCCCC(O[Si](C)C)C(C)(C)C)CC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H51O4Si/c1-20(32)34-28-15-14-26-29-21(10-8-9-11-27(30(2,3)4)35-36(6)7)18-22-19-23(33)12-13-24(22)25(29)16-17-31(26,28)5/h19,21,24-29H,8-18H2,1-7H3/t21-,24+,25-,26+,27?,28+,29-,31+/m1/s1 |
| InChIKey | RGAADGQYESPLGT-FFDJASECSA-N |
| XLogP | 7.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.83 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|