C25H38O4 — CID 57134965
[(7R,8R,9S,10R,13S,14S,17R)-7-(5-hydroxypentyl)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 57134965) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(7R,8R,9S,10R,13S,14S,17R)-7-(5-hydroxypentyl)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,10R,13S,14S,17R)-7-(5-hydroxypentyl)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 57134965 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(7R,8R,9S,10R,13S,14S,17R)-7-(5-hydroxypentyl)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@H]2[C@@H]3[C@H](CCCCCO)CC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38O4/c1-16(27)29-23-10-9-22-24-17(6-4-3-5-13-26)14-18-15-19(28)7-8-20(18)21(24)11-12-25(22,23)2/h15,17,20-24,26H,3-14H2,1-2H3/t17-,20+,21-,22+,23-,24-,25+/m1/s1 |
| InChIKey | OWHFZPNKWZFBLN-KWIFDMFUSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|