C34H55F3O3S — CID 177335598
(13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate;1-(5,5,5-trifluoropentylsulfanyl)nonane (PubChem CID 177335598) has the molecular formula C34H55F3O3S and a molecular weight of 600.87 g/mol. Its IUPAC name is (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate;1-(5,5,5-trifluoropentylsulfanyl)nonane.
| Compound Name | (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate;1-(5,5,5-trifluoropentylsulfanyl)nonane |
|---|---|
| PubChem CID | 177335598 |
| Molecular Formula | C34H55F3O3S |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | (13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate;1-(5,5,5-trifluoropentylsulfanyl)nonane |
| SMILES | CC(=O)OC1CCC2C3CCC4=CC(=O)CCC4C3CCC12C.CCCCCCCCCSCCCCC(F)(F)F |
| InChI | InChI=1S/C20H28O3.C14H27F3S/c1-12(21)23-19-8-7-18-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2;1-2-3-4-5-6-7-9-12-18-13-10-8-11-14(15,16)17/h11,15-19H,3-10H2,1-2H3;2-13H2,1H3 |
| InChIKey | FUVLZRZKMCPNHQ-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|