C33H46O4 — CID 118646125
[(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-hexoxy-2-phenylpropanoate (PubChem CID 118646125) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-hexoxy-2-phenylpropanoate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-hexoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 118646125 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-hexoxy-2-phenylpropanoate |
| SMILES | CCCCCCOC(C)(C(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C)c1ccccc1 |
| InChI | InChI=1S/C33H46O4/c1-4-5-6-10-21-36-33(3,24-11-8-7-9-12-24)31(35)37-30-18-17-29-28-15-13-23-22-25(34)14-16-26(23)27(28)19-20-32(29,30)2/h7-9,11-12,22,26-30H,4-6,10,13-21H2,1-3H3/t26-,27+,28+,29-,30-,32-,33?/m0/s1 |
| InChIKey | NJXBAVVZUOANEB-NJEYQAQCSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|